C19H18F5NO6S — CID 19081780
ethyl 1-cyclohexyl-6,8-difluoro-4-oxo-7-(trifluoromethylsulfonyloxy)quinoline-2-carboxylate (PubChem CID 19081780) has the molecular formula C19H18F5NO6S and a molecular weight of 483.41 g/mol. Its IUPAC name is ethyl 1-cyclohexyl-6,8-difluoro-4-oxo-7-(trifluoromethylsulfonyloxy)quinoline-2-carboxylate.
| Compound Name | ethyl 1-cyclohexyl-6,8-difluoro-4-oxo-7-(trifluoromethylsulfonyloxy)quinoline-2-carboxylate |
|---|---|
| PubChem CID | 19081780 |
| Molecular Formula | C19H18F5NO6S |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | ethyl 1-cyclohexyl-6,8-difluoro-4-oxo-7-(trifluoromethylsulfonyloxy)quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2cc(F)c(OS(=O)(=O)C(F)(F)F)c(F)c2n1C1CCCCC1 |
| InChI | InChI=1S/C19H18F5NO6S/c1-2-30-18(27)13-9-14(26)11-8-12(20)17(31-32(28,29)19(22,23)24)15(21)16(11)25(13)10-6-4-3-5-7-10/h8-10H,2-7H2,1H3 |
| InChIKey | XLQFYSMTENQOMM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|