About triphenoxyphosphanium iodide
triphenoxyphosphanium iodide (PubChem CID 19082624) has the molecular formula C18H16IO3P
and a molecular weight of 438.20 g/mol. Its IUPAC name is triphenoxyphosphanium iodide.
Molecular Properties
| Compound Name | triphenoxyphosphanium iodide |
| PubChem CID | 19082624 |
| Molecular Formula | C18H16IO3P |
| Molecular Weight | 438.20 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | triphenoxyphosphanium iodide |
| SMILES | [I-].c1ccc(O[PH+](Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H16O3P.HI/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;/h1-15,22H;1H/q+1;/p-1 |
| InChIKey | NRYHHPPWSNDNSY-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenoxyphosphanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenoxyphosphanium iodide?
The IUPAC name of triphenoxyphosphanium iodide (CID 19082624) is triphenoxyphosphanium iodide.
What is the SMILES notation for triphenoxyphosphanium iodide?
The canonical SMILES for triphenoxyphosphanium iodide is [I-].c1ccc(O[PH+](Oc2ccccc2)Oc2ccccc2)cc1.
What is the InChIKey of triphenoxyphosphanium iodide?
The InChIKey is NRYHHPPWSNDNSY-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H16O3P.HI/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;/h1-15,22H;1H/q+1;/p-1.
What are the key properties of triphenoxyphosphanium iodide?
triphenoxyphosphanium iodide has a molecular weight of 438.20 g/mol, XLogP of 2.19, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triphenoxyphosphanium iodide is sourced from PubChem (CID 19082624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).