C17H14Cl2N2O2S — CID 19088739
2-(2,4-dichlorophenyl)butyl 1,2,3-benzothiadiazole-7-carboxylate (PubChem CID 19088739) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)butyl 1,2,3-benzothiadiazole-7-carboxylate.
| Compound Name | 2-(2,4-dichlorophenyl)butyl 1,2,3-benzothiadiazole-7-carboxylate |
|---|---|
| PubChem CID | 19088739 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-(2,4-dichlorophenyl)butyl 1,2,3-benzothiadiazole-7-carboxylate |
| SMILES | CCC(COC(=O)c1cccc2nnsc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O2S/c1-2-10(12-7-6-11(18)8-14(12)19)9-23-17(22)13-4-3-5-15-16(13)24-21-20-15/h3-8,10H,2,9H2,1H3 |
| InChIKey | XQGZXEQEFPQKDM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |