C23H34FNO2 — CID 19120200
4-butyl-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)cyclohexane-1-carboxamide (PubChem CID 19120200) has the molecular formula C23H34FNO2 and a molecular weight of 375.53 g/mol. Its IUPAC name is 4-butyl-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 19120200 |
| Molecular Formula | C23H34FNO2 |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 4-butyl-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)N(Cc2ccccc2F)CC2CCCO2)CC1 |
| InChI | InChI=1S/C23H34FNO2/c1-2-3-7-18-11-13-19(14-12-18)23(26)25(17-21-9-6-15-27-21)16-20-8-4-5-10-22(20)24/h4-5,8,10,18-19,21H,2-3,6-7,9,11-17H2,1H3 |
| InChIKey | VLZMUOTYNBACAY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |