C25H15Cl2N3O5 — CID 19122085
[2-amino-3-cyano-4-(4-nitrophenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 19122085) has the molecular formula C25H15Cl2N3O5 and a molecular weight of 508.32 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-nitrophenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-(4-nitrophenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19122085 |
| Molecular Formula | C25H15Cl2N3O5 |
| Molecular Weight | 508.32 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | [2-amino-3-cyano-4-(4-nitrophenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)/C=C/c3ccc(Cl)cc3Cl)ccc2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H15Cl2N3O5/c26-16-5-1-14(21(27)11-16)4-10-23(31)34-18-8-9-19-22(12-18)35-25(29)20(13-28)24(19)15-2-6-17(7-3-15)30(32)33/h1-12,24H,29H2/b10-4+ |
| InChIKey | FKZHOZDPSJXQEZ-ONNFQVAWSA-N |
| XLogP | 5.74 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|