C27H20Cl2N2O5 — CID 19123044
[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 19123044) has the molecular formula C27H20Cl2N2O5 and a molecular weight of 523.37 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19123044 |
| Molecular Formula | C27H20Cl2N2O5 |
| Molecular Weight | 523.37 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(C2C(C#N)=C(N)Oc3cc(OC(=O)/C=C/c4ccc(Cl)cc4Cl)ccc32)c1 |
| InChI | InChI=1S/C27H20Cl2N2O5/c1-33-17-7-9-23(34-2)20(12-17)26-19-8-6-18(13-24(19)36-27(31)21(26)14-30)35-25(32)10-4-15-3-5-16(28)11-22(15)29/h3-13,26H,31H2,1-2H3/b10-4+ |
| InChIKey | CAXFRJYXKHONCA-ONNFQVAWSA-N |
| XLogP | 5.85 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.37 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|