C28H20Cl2N2O4 — CID 19122644
[2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 19122644) has the molecular formula C28H20Cl2N2O4 and a molecular weight of 519.38 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19122644 |
| Molecular Formula | C28H20Cl2N2O4 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)/C=C/c4ccc(Cl)cc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C28H20Cl2N2O4/c1-2-13-34-20-8-4-18(5-9-20)27-22-11-10-21(15-25(22)36-28(32)23(27)16-31)35-26(33)12-6-17-3-7-19(29)14-24(17)30/h2-12,14-15,27H,1,13,32H2/b12-6+ |
| InChIKey | MDOSQIWOTINGRW-WUXMJOGZSA-N |
| XLogP | 6.40 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|