C23H23N3O7S — CID 19203704
N-[2,5-diethoxy-4-[(2-nitrophenyl)sulfonylamino]phenyl]benzamide (PubChem CID 19203704) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[(2-nitrophenyl)sulfonylamino]phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-[(2-nitrophenyl)sulfonylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 19203704 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[2,5-diethoxy-4-[(2-nitrophenyl)sulfonylamino]phenyl]benzamide |
| SMILES | CCOc1cc(NS(=O)(=O)c2ccccc2[N+](=O)[O-])c(OCC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O7S/c1-3-32-20-15-18(25-34(30,31)22-13-9-8-12-19(22)26(28)29)21(33-4-2)14-17(20)24-23(27)16-10-6-5-7-11-16/h5-15,25H,3-4H2,1-2H3,(H,24,27) |
| InChIKey | AULIIBWOYNIMIU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|