C29H21NO4 — CID 19205343
[3-(1,3-dioxoisoindol-2-yl)phenyl] 2-(2-phenylethyl)benzoate (PubChem CID 19205343) has the molecular formula C29H21NO4 and a molecular weight of 447.49 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)phenyl] 2-(2-phenylethyl)benzoate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)phenyl] 2-(2-phenylethyl)benzoate |
|---|---|
| PubChem CID | 19205343 |
| Molecular Formula | C29H21NO4 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)phenyl] 2-(2-phenylethyl)benzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)c3ccccc3C2=O)c1)c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C29H21NO4/c31-27-25-15-6-7-16-26(25)28(32)30(27)22-12-8-13-23(19-22)34-29(33)24-14-5-4-11-21(24)18-17-20-9-2-1-3-10-20/h1-16,19H,17-18H2 |
| InChIKey | UVVFMGFKCWCDDC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|