C40H28N2O6 — CID 161175486
2-[3-[1,3-dioxo-5-(3-phenylpropanoyl)isoindol-2-yl]phenyl]-5-(3-phenylpropanoyl)isoindole-1,3-dione (PubChem CID 161175486) has the molecular formula C40H28N2O6 and a molecular weight of 632.67 g/mol. Its IUPAC name is 2-[3-[1,3-dioxo-5-(3-phenylpropanoyl)isoindol-2-yl]phenyl]-5-(3-phenylpropanoyl)isoindole-1,3-dione.
| Compound Name | 2-[3-[1,3-dioxo-5-(3-phenylpropanoyl)isoindol-2-yl]phenyl]-5-(3-phenylpropanoyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 161175486 |
| Molecular Formula | C40H28N2O6 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 2-[3-[1,3-dioxo-5-(3-phenylpropanoyl)isoindol-2-yl]phenyl]-5-(3-phenylpropanoyl)isoindole-1,3-dione |
| SMILES | O=C(CCc1ccccc1)c1ccc2c(c1)C(=O)N(c1cccc(N3C(=O)c4ccc(C(=O)CCc5ccccc5)cc4C3=O)c1)C2=O |
| InChI | InChI=1S/C40H28N2O6/c43-35(20-14-25-8-3-1-4-9-25)27-16-18-31-33(22-27)39(47)41(37(31)45)29-12-7-13-30(24-29)42-38(46)32-19-17-28(23-34(32)40(42)48)36(44)21-15-26-10-5-2-6-11-26/h1-13,16-19,22-24H,14-15,20-21H2 |
| InChIKey | URTBSFVHTHOJSX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|