C23H27N3O2 — CID 19244672
4-tert-butyl-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]benzamide (PubChem CID 19244672) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19244672 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-tert-butyl-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]benzamide |
| SMILES | CCc1ccc(CC)c(-c2nonc2NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H27N3O2/c1-6-15-8-9-16(7-2)19(14-15)20-21(26-28-25-20)24-22(27)17-10-12-18(13-11-17)23(3,4)5/h8-14H,6-7H2,1-5H3,(H,24,26,27) |
| InChIKey | CADLDQVKLGWLKF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |