C22H23N3O2 — CID 19244691
(E)-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 19244691) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (E)-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19244691 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (E)-N-[4-(2,5-diethylphenyl)-1,2,5-oxadiazol-3-yl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(CC)c(-c2nonc2NC(=O)/C=C/c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-4-16-10-12-18(5-2)19(14-16)21-22(25-27-24-21)23-20(26)13-11-17-8-6-15(3)7-9-17/h6-14H,4-5H2,1-3H3,(H,23,25,26)/b13-11+ |
| InChIKey | VRTVBCQUJUSKOM-ACCUITESSA-N |
| XLogP | 4.82 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|