C15H9FN2O2S — CID 19245212
3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-3H-2-benzofuran-1-one (PubChem CID 19245212) has the molecular formula C15H9FN2O2S and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-3H-2-benzofuran-1-one.
| Compound Name | 3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 19245212 |
| Molecular Formula | C15H9FN2O2S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(Nc2nc3ccc(F)cc3s2)c2ccccc21 |
| InChI | InChI=1S/C15H9FN2O2S/c16-8-5-6-11-12(7-8)21-15(17-11)18-13-9-3-1-2-4-10(9)14(19)20-13/h1-7,13H,(H,17,18) |
| InChIKey | SLZHZAZTFRWLOI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |