C27H29N5O — CID 19260382
N'-(4-ethoxyphenyl)-N-[(E)-2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]pyridine-2-carboximidamide (PubChem CID 19260382) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)-N-[(E)-2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]pyridine-2-carboximidamide.
| Compound Name | N'-(4-ethoxyphenyl)-N-[(E)-2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 19260382 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N'-(4-ethoxyphenyl)-N-[(E)-2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]pyridine-2-carboximidamide |
| SMILES | CCOc1ccc(/N=C(/N/N=C/C=C2N(C)c3ccccc3C2(C)C)c2ccccn2)cc1 |
| InChI | InChI=1S/C27H29N5O/c1-5-33-21-15-13-20(14-16-21)30-26(23-11-8-9-18-28-23)31-29-19-17-25-27(2,3)22-10-6-7-12-24(22)32(25)4/h6-19H,5H2,1-4H3,(H,30,31)/b25-17?,29-19+ |
| InChIKey | OROYHSOPEVHPBD-DIBWVBMASA-N |
| XLogP | 5.45 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|