C18H16N4O2 — CID 19290151
[(Z)-[amino(phenyl)methylidene]amino] 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate (PubChem CID 19290151) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is [(Z)-[amino(phenyl)methylidene]amino] 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | [(Z)-[amino(phenyl)methylidene]amino] 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19290151 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(Z)-[amino(phenyl)methylidene]amino] 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)O/N=C(\N)c3ccccc3)[nH]n2)cc1 |
| InChI | InChI=1S/C18H16N4O2/c1-12-7-9-13(10-8-12)15-11-16(21-20-15)18(23)24-22-17(19)14-5-3-2-4-6-14/h2-11H,1H3,(H2,19,22)(H,20,21) |
| InChIKey | JKTPKMYHFNYMNQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|