C30H22Cl2N6O2S — CID 19300329
N-[(E)-1-(2,3-dichlorophenyl)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]prop-1-en-2-yl]benzamide (PubChem CID 19300329) has the molecular formula C30H22Cl2N6O2S and a molecular weight of 601.52 g/mol. Its IUPAC name is N-[(E)-1-(2,3-dichlorophenyl)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,3-dichlorophenyl)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300329 |
| Molecular Formula | C30H22Cl2N6O2S |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | N-[(E)-1-(2,3-dichlorophenyl)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCc2nnnn2-c2ccccc2)c1)/C(=C\c1cccc(Cl)c1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H22Cl2N6O2S/c31-25-16-7-11-21(28(25)32)17-26(34-29(39)20-9-3-1-4-10-20)30(40)33-22-12-8-15-24(18-22)41-19-27-35-36-37-38(27)23-13-5-2-6-14-23/h1-18H,19H2,(H,33,40)(H,34,39)/b26-17+ |
| InChIKey | FFBDILLZEAZGPS-YZSQISJMSA-N |
| XLogP | 6.67 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|