C33H30N6O5S — CID 19300949
N-[(E)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19300949) has the molecular formula C33H30N6O5S and a molecular weight of 622.71 g/mol. Its IUPAC name is N-[(E)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300949 |
| Molecular Formula | C33H30N6O5S |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | N-[(E)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCc3nnnn3-c3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C33H30N6O5S/c1-42-28-18-22(19-29(43-2)31(28)44-3)17-27(35-32(40)23-11-6-4-7-12-23)33(41)34-24-13-10-16-26(20-24)45-21-30-36-37-38-39(30)25-14-8-5-9-15-25/h4-20H,21H2,1-3H3,(H,34,41)(H,35,40)/b27-17+ |
| InChIKey | YEQRWVYLKBJAHS-WPWMEQJKSA-N |
| XLogP | 5.39 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|