C32H28N6O4S — CID 19300421
N-[(E)-1-(2,4-dimethoxyphenyl)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]prop-1-en-2-yl]benzamide (PubChem CID 19300421) has the molecular formula C32H28N6O4S and a molecular weight of 592.68 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dimethoxyphenyl)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dimethoxyphenyl)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300421 |
| Molecular Formula | C32H28N6O4S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | N-[(E)-1-(2,4-dimethoxyphenyl)-3-oxo-3-[3-[(1-phenyltetrazol-5-yl)methylsulfanyl]anilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCc3nnnn3-c3ccccc3)c2)c(OC)c1 |
| InChI | InChI=1S/C32H28N6O4S/c1-41-26-17-16-23(29(20-26)42-2)18-28(34-31(39)22-10-5-3-6-11-22)32(40)33-24-12-9-15-27(19-24)43-21-30-35-36-37-38(30)25-13-7-4-8-14-25/h3-20H,21H2,1-2H3,(H,33,40)(H,34,39)/b28-18+ |
| InChIKey | CWUDWDJTFCHGIT-MTDXEUNCSA-N |
| XLogP | 5.38 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|