C30H30N2O6S — CID 19300405
ethyl (E)-4-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbut-2-enoate (PubChem CID 19300405) has the molecular formula C30H30N2O6S and a molecular weight of 546.65 g/mol. Its IUPAC name is ethyl (E)-4-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbut-2-enoate.
| Compound Name | ethyl (E)-4-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbut-2-enoate |
|---|---|
| PubChem CID | 19300405 |
| Molecular Formula | C30H30N2O6S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | ethyl (E)-4-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbut-2-enoate |
| SMILES | CCOC(=O)/C=C/CSc1cccc(NC(=O)/C(=C\c2ccc(OC)cc2OC)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H30N2O6S/c1-4-38-28(33)14-9-17-39-25-13-8-12-23(19-25)31-30(35)26(32-29(34)21-10-6-5-7-11-21)18-22-15-16-24(36-2)20-27(22)37-3/h5-16,18-20H,4,17H2,1-3H3,(H,31,35)(H,32,34)/b14-9+,26-18+ |
| InChIKey | RYFOFDYRHZJDBH-GTWLMMJMSA-N |
| XLogP | 5.32 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|