C26H24N2O5S — CID 19300657
ethyl (E)-4-[3-[[(E)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylbut-2-enoate (PubChem CID 19300657) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is ethyl (E)-4-[3-[[(E)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylbut-2-enoate.
| Compound Name | ethyl (E)-4-[3-[[(E)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylbut-2-enoate |
|---|---|
| PubChem CID | 19300657 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | ethyl (E)-4-[3-[[(E)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylbut-2-enoate |
| SMILES | CCOC(=O)/C=C/CSc1cccc(NC(=O)/C(=C\c2ccco2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N2O5S/c1-2-32-24(29)14-8-16-34-22-13-6-11-20(17-22)27-26(31)23(18-21-12-7-15-33-21)28-25(30)19-9-4-3-5-10-19/h3-15,17-18H,2,16H2,1H3,(H,27,31)(H,28,30)/b14-8+,23-18+ |
| InChIKey | HARWIXCCUYZENG-SIPFBABESA-N |
| XLogP | 4.90 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|