C34H28N2O7S — CID 19300384
N-[(E)-1-(2,3-dimethoxyphenyl)-3-[3-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19300384) has the molecular formula C34H28N2O7S and a molecular weight of 608.67 g/mol. Its IUPAC name is N-[(E)-1-(2,3-dimethoxyphenyl)-3-[3-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,3-dimethoxyphenyl)-3-[3-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300384 |
| Molecular Formula | C34H28N2O7S |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | N-[(E)-1-(2,3-dimethoxyphenyl)-3-[3-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCc3cc4ccc(O)cc4oc3=O)c2)c1OC |
| InChI | InChI=1S/C34H28N2O7S/c1-41-29-13-6-10-23(31(29)42-2)17-28(36-32(38)21-8-4-3-5-9-21)33(39)35-25-11-7-12-27(18-25)44-20-24-16-22-14-15-26(37)19-30(22)43-34(24)40/h3-19,37H,20H2,1-2H3,(H,35,39)(H,36,38)/b28-17+ |
| InChIKey | KPKIJSNWJKVTHV-OGLMXYFKSA-N |
| XLogP | 6.22 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|