C33H26N2O6S — CID 19300522
N-[(Z)-3-[3-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19300522) has the molecular formula C33H26N2O6S and a molecular weight of 578.65 g/mol. Its IUPAC name is N-[(Z)-3-[3-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300522 |
| Molecular Formula | C33H26N2O6S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | N-[(Z)-3-[3-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1cccc(SCc2cc3ccc(O)cc3oc2=O)c1 |
| InChI | InChI=1S/C33H26N2O6S/c1-40-29-13-6-5-10-22(29)17-28(35-31(37)21-8-3-2-4-9-21)32(38)34-25-11-7-12-27(18-25)42-20-24-16-23-14-15-26(36)19-30(23)41-33(24)39/h2-19,36H,20H2,1H3,(H,34,38)(H,35,37)/b28-17- |
| InChIKey | RXPPVUNQKFQSNY-QRQIAZFYSA-N |
| XLogP | 6.21 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|