C32H23FN2O5S — CID 22784146
N-[(Z)-1-(4-fluorophenyl)-3-[4-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22784146) has the molecular formula C32H23FN2O5S and a molecular weight of 566.61 g/mol. Its IUPAC name is N-[(Z)-1-(4-fluorophenyl)-3-[4-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-fluorophenyl)-3-[4-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784146 |
| Molecular Formula | C32H23FN2O5S |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | N-[(Z)-1-(4-fluorophenyl)-3-[4-[(7-hydroxy-2-oxochromen-3-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCc2cc3ccc(O)cc3oc2=O)cc1)/C(=C/c1ccc(F)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H23FN2O5S/c33-24-9-6-20(7-10-24)16-28(35-30(37)21-4-2-1-3-5-21)31(38)34-25-11-14-27(15-12-25)41-19-23-17-22-8-13-26(36)18-29(22)40-32(23)39/h1-18,36H,19H2,(H,34,38)(H,35,37)/b28-16- |
| InChIKey | LCSZFPRIGISUHS-NTFVMDSBSA-N |
| XLogP | 6.34 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|