C11H15ClN6S — CID 19327166
1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(1,5-dimethylpyrazol-4-yl)thiourea (PubChem CID 19327166) has the molecular formula C11H15ClN6S and a molecular weight of 298.80 g/mol. Its IUPAC name is 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(1,5-dimethylpyrazol-4-yl)thiourea.
| Compound Name | 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(1,5-dimethylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 19327166 |
| Molecular Formula | C11H15ClN6S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(1,5-dimethylpyrazol-4-yl)thiourea |
| SMILES | Cc1c(NC(=S)NCc2c(Cl)cnn2C)cnn1C |
| InChI | InChI=1S/C11H15ClN6S/c1-7-9(5-15-17(7)2)16-11(19)13-6-10-8(12)4-14-18(10)3/h4-5H,6H2,1-3H3,(H2,13,16,19) |
| InChIKey | SLBWCNHVCYQVRF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|