C19H21F3N2 — CID 19350148
5,10-diethyl-1,2-dimethyl-7-(trifluoromethyl)phenazine (PubChem CID 19350148) has the molecular formula C19H21F3N2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 5,10-diethyl-1,2-dimethyl-7-(trifluoromethyl)phenazine.
| Compound Name | 5,10-diethyl-1,2-dimethyl-7-(trifluoromethyl)phenazine |
|---|---|
| PubChem CID | 19350148 |
| Molecular Formula | C19H21F3N2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 5,10-diethyl-1,2-dimethyl-7-(trifluoromethyl)phenazine |
| SMILES | CCN1c2cc(C(F)(F)F)ccc2N(CC)c2c1ccc(C)c2C |
| InChI | InChI=1S/C19H21F3N2/c1-5-23-16-9-7-12(3)13(4)18(16)24(6-2)15-10-8-14(11-17(15)23)19(20,21)22/h7-11H,5-6H2,1-4H3 |
| InChIKey | AJTRMNKIKYUDKB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |