C32H36F3N3O4 — CID 19353919
6-(3-piperidin-1-ylpropoxy)-1-[[2-(trifluoromethyl)phenyl]methyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole (PubChem CID 19353919) has the molecular formula C32H36F3N3O4 and a molecular weight of 583.65 g/mol. Its IUPAC name is 6-(3-piperidin-1-ylpropoxy)-1-[[2-(trifluoromethyl)phenyl]methyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole.
| Compound Name | 6-(3-piperidin-1-ylpropoxy)-1-[[2-(trifluoromethyl)phenyl]methyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 19353919 |
| Molecular Formula | C32H36F3N3O4 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 6-(3-piperidin-1-ylpropoxy)-1-[[2-(trifluoromethyl)phenyl]methyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole |
| SMILES | COc1cc(-c2nc3ccc(OCCCN4CCCCC4)cc3n2Cc2ccccc2C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C32H36F3N3O4/c1-39-28-18-23(19-29(40-2)30(28)41-3)31-36-26-13-12-24(42-17-9-16-37-14-7-4-8-15-37)20-27(26)38(31)21-22-10-5-6-11-25(22)32(33,34)35/h5-6,10-13,18-20H,4,7-9,14-17,21H2,1-3H3 |
| InChIKey | WYFVTXDSJNYXQR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 57.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|