C17H25NO3 — CID 19363243
2-(4-methoxy-3-pentoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 19363243) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-(4-methoxy-3-pentoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(4-methoxy-3-pentoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 19363243 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-(4-methoxy-3-pentoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCCOc1cc(C2=NC(C)(C)CO2)ccc1OC |
| InChI | InChI=1S/C17H25NO3/c1-5-6-7-10-20-15-11-13(8-9-14(15)19-4)16-18-17(2,3)12-21-16/h8-9,11H,5-7,10,12H2,1-4H3 |
| InChIKey | OQCRZPHKGVCIRP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|