C9H12NO2- — CID 19365037
(E)-4-[[(2E)-penta-2,4-dienyl]amino]but-2-enoate (PubChem CID 19365037) has the molecular formula C9H12NO2- and a molecular weight of 166.20 g/mol. Its IUPAC name is (E)-4-[[(2E)-penta-2,4-dienyl]amino]but-2-enoate.
| Compound Name | (E)-4-[[(2E)-penta-2,4-dienyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19365037 |
| Molecular Formula | C9H12NO2- |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | (E)-4-[[(2E)-penta-2,4-dienyl]amino]but-2-enoate |
| SMILES | C=C/C=C/CNC/C=C/C(=O)[O-] |
| InChI | InChI=1S/C9H13NO2/c1-2-3-4-7-10-8-5-6-9(11)12/h2-6,10H,1,7-8H2,(H,11,12)/p-1/b4-3+,6-5+ |
| InChIKey | YEPRFBKHKWROAL-VNKDHWASSA-M |
| XLogP | -0.38 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|