C38H74O4S2Zn — CID 19367360
zinc bis(2,8-dimethyl-2-(6-methylheptylsulfanyl)nonanoate) (PubChem CID 19367360) has the molecular formula C38H74O4S2Zn and a molecular weight of 724.53 g/mol. Its IUPAC name is zinc bis(2,8-dimethyl-2-(6-methylheptylsulfanyl)nonanoate).
| Compound Name | zinc bis(2,8-dimethyl-2-(6-methylheptylsulfanyl)nonanoate) |
|---|---|
| PubChem CID | 19367360 |
| Molecular Formula | C38H74O4S2Zn |
| Molecular Weight | 724.53 g/mol |
| Exact Mass | 722.43 |
| IUPAC Name | zinc bis(2,8-dimethyl-2-(6-methylheptylsulfanyl)nonanoate) |
| SMILES | CC(C)CCCCCSC(C)(CCCCCC(C)C)C(=O)[O-].CC(C)CCCCCSC(C)(CCCCCC(C)C)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C19H38O2S.Zn/c2*1-16(2)12-8-6-10-14-19(5,18(20)21)22-15-11-7-9-13-17(3)4;/h2*16-17H,6-15H2,1-5H3,(H,20,21);/q;;+2/p-2 |
| InChIKey | ZDIGCYMKWNRMPU-UHFFFAOYSA-L |
| XLogP | 10.10 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.53 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|