C22H28FN3OS2 — CID 19372934
5-[6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexylsulfanyl]thiophen-2-amine (PubChem CID 19372934) has the molecular formula C22H28FN3OS2 and a molecular weight of 433.62 g/mol. Its IUPAC name is 5-[6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexylsulfanyl]thiophen-2-amine.
| Compound Name | 5-[6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexylsulfanyl]thiophen-2-amine |
|---|---|
| PubChem CID | 19372934 |
| Molecular Formula | C22H28FN3OS2 |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 5-[6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexylsulfanyl]thiophen-2-amine |
| SMILES | Nc1ccc(SCCCCCCN2CCC(c3noc4cc(F)ccc34)CC2)s1 |
| InChI | InChI=1S/C22H28FN3OS2/c23-17-5-6-18-19(15-17)27-25-22(18)16-9-12-26(13-10-16)11-3-1-2-4-14-28-21-8-7-20(24)29-21/h5-8,15-16H,1-4,9-14,24H2 |
| InChIKey | OANYKFKCJBDEMM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|