C22H22FN5O2S — CID 54767290
6-fluoro-3-[1-[3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propyl]piperidin-4-yl]-1,2-benzoxazole (PubChem CID 54767290) has the molecular formula C22H22FN5O2S and a molecular weight of 439.52 g/mol. Its IUPAC name is 6-fluoro-3-[1-[3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propyl]piperidin-4-yl]-1,2-benzoxazole.
| Compound Name | 6-fluoro-3-[1-[3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propyl]piperidin-4-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 54767290 |
| Molecular Formula | C22H22FN5O2S |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 6-fluoro-3-[1-[3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propyl]piperidin-4-yl]-1,2-benzoxazole |
| SMILES | Fc1ccc2c(C3CCN(CCCSc4nnc(-c5ccncc5)o4)CC3)noc2c1 |
| InChI | InChI=1S/C22H22FN5O2S/c23-17-2-3-18-19(14-17)30-27-20(18)15-6-11-28(12-7-15)10-1-13-31-22-26-25-21(29-22)16-4-8-24-9-5-16/h2-5,8-9,14-15H,1,6-7,10-13H2 |
| InChIKey | CXCUBZJGGQAXFK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|