C17H11NO5 — CID 19374775
2-(9-phenylnona-2,5,8-triynoxy)-1,3,2-dioxazolidine-4,5-dione (PubChem CID 19374775) has the molecular formula C17H11NO5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-(9-phenylnona-2,5,8-triynoxy)-1,3,2-dioxazolidine-4,5-dione.
| Compound Name | 2-(9-phenylnona-2,5,8-triynoxy)-1,3,2-dioxazolidine-4,5-dione |
|---|---|
| PubChem CID | 19374775 |
| Molecular Formula | C17H11NO5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-(9-phenylnona-2,5,8-triynoxy)-1,3,2-dioxazolidine-4,5-dione |
| SMILES | O=c1on(OCC#CCC#CCC#Cc2ccccc2)oc1=O |
| InChI | InChI=1S/C17H11NO5/c19-16-17(20)23-18(22-16)21-14-10-5-3-1-2-4-7-11-15-12-8-6-9-13-15/h6,8-9,12-13H,3-4,14H2 |
| InChIKey | OHWAPXVXZICHKT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 74.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|