C6H11NOS2 — CID 19378106
3,5-bis(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 19378106) has the molecular formula C6H11NOS2 and a molecular weight of 177.29 g/mol. Its IUPAC name is 3,5-bis(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 3,5-bis(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 19378106 |
| Molecular Formula | C6H11NOS2 |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 3,5-bis(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1NC(CS)CC1CS |
| InChI | InChI=1S/C6H11NOS2/c8-6-4(2-9)1-5(3-10)7-6/h4-5,9-10H,1-3H2,(H,7,8) |
| InChIKey | PRNVSOBQUQVKPT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|