C17H23NO3S — CID 10519819
(3S,6R)-5-oxo-6-(sulfanylmethyl)-4-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-3-carboxylic acid (PubChem CID 10519819) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (3S,6R)-5-oxo-6-(sulfanylmethyl)-4-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-3-carboxylic acid.
| Compound Name | (3S,6R)-5-oxo-6-(sulfanylmethyl)-4-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 10519819 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3S,6R)-5-oxo-6-(sulfanylmethyl)-4-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-3-carboxylic acid |
| SMILES | O=C1N[C@H](C(=O)O)Cc2ccccc2CCCCC[C@H]1CS |
| InChI | InChI=1S/C17H23NO3S/c19-16-14(11-22)9-3-1-2-6-12-7-4-5-8-13(12)10-15(18-16)17(20)21/h4-5,7-8,14-15,22H,1-3,6,9-11H2,(H,18,19)(H,20,21)/t14-,15-/m0/s1 |
| InChIKey | SEWLVLMEAAFQQO-GJZGRUSLSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|