C17H21NO5 — CID 10805569
(6S)-4-oxo-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-3,6-dicarboxylic acid (PubChem CID 10805569) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (6S)-4-oxo-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-3,6-dicarboxylic acid.
| Compound Name | (6S)-4-oxo-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 10805569 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (6S)-4-oxo-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-3,6-dicarboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2CCCCC[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C17H21NO5/c19-15-13(16(20)21)10-12-8-5-4-7-11(12)6-2-1-3-9-14(18-15)17(22)23/h4-5,7-8,13-14H,1-3,6,9-10H2,(H,18,19)(H,20,21)(H,22,23)/t13?,14-/m0/s1 |
| InChIKey | MFULRHIYWVPAIW-KZUDCZAMSA-N |
| XLogP | 1.62 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|