C20H36N4O4S2 — CID 174179474
(3R,7S,10R,14S)-7,14-bis(2-methylpropyl)-3,10-bis(sulfanylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone (PubChem CID 174179474) has the molecular formula C20H36N4O4S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is (3R,7S,10R,14S)-7,14-bis(2-methylpropyl)-3,10-bis(sulfanylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone.
| Compound Name | (3R,7S,10R,14S)-7,14-bis(2-methylpropyl)-3,10-bis(sulfanylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone |
|---|---|
| PubChem CID | 174179474 |
| Molecular Formula | C20H36N4O4S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (3R,7S,10R,14S)-7,14-bis(2-methylpropyl)-3,10-bis(sulfanylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone |
| SMILES | CC(C)C[C@H]1CC(=O)N[C@@H](CS)C(=O)N[C@@H](CC(C)C)CC(=O)N[C@@H](CS)C(=O)N1 |
| InChI | InChI=1S/C20H36N4O4S2/c1-11(2)5-13-7-17(25)23-16(10-30)20(28)22-14(6-12(3)4)8-18(26)24-15(9-29)19(27)21-13/h11-16,29-30H,5-10H2,1-4H3,(H,21,27)(H,22,28)(H,23,25)(H,24,26)/t13-,14-,15-,16-/m0/s1 |
| InChIKey | CKOYSOWVRJSQMJ-VGWMRTNUSA-N |
| XLogP | 0.67 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|