C16H20N5O5P — CID 19419728
3-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]amino]propylphosphonic acid (PubChem CID 19419728) has the molecular formula C16H20N5O5P and a molecular weight of 393.34 g/mol. Its IUPAC name is 3-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]amino]propylphosphonic acid.
| Compound Name | 3-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]amino]propylphosphonic acid |
|---|---|
| PubChem CID | 19419728 |
| Molecular Formula | C16H20N5O5P |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-[[6-(4-carbamimidoylphenyl)-2-methyl-3-oxopyridazine-4-carbonyl]amino]propylphosphonic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2cc(C(=O)NCCCP(=O)(O)O)c(=O)n(C)n2)cc1 |
| InChI | InChI=1S/C16H20N5O5P/c1-21-16(23)12(15(22)19-7-2-8-27(24,25)26)9-13(20-21)10-3-5-11(6-4-10)14(17)18/h3-6,9H,2,7-8H2,1H3,(H3,17,18)(H,19,22)(H2,24,25,26) |
| InChIKey | FVOVIAWIGOYRFL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 171.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|