C23H24Cl2N2O2 — CID 19421899
3-(3,4-dichlorophenyl)-1-(1-phenyl-2-pyrrolidin-1-ylethyl)piperidine-2,4-dione (PubChem CID 19421899) has the molecular formula C23H24Cl2N2O2 and a molecular weight of 431.36 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-(1-phenyl-2-pyrrolidin-1-ylethyl)piperidine-2,4-dione.
| Compound Name | 3-(3,4-dichlorophenyl)-1-(1-phenyl-2-pyrrolidin-1-ylethyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 19421899 |
| Molecular Formula | C23H24Cl2N2O2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-(1-phenyl-2-pyrrolidin-1-ylethyl)piperidine-2,4-dione |
| SMILES | O=C1CCN(C(CN2CCCC2)c2ccccc2)C(=O)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2N2O2/c24-18-9-8-17(14-19(18)25)22-21(28)10-13-27(23(22)29)20(15-26-11-4-5-12-26)16-6-2-1-3-7-16/h1-3,6-9,14,20,22H,4-5,10-13,15H2 |
| InChIKey | VJNQABGAEUNALB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|