C24H27F3N2O — CID 19421901
3-phenyl-1-(1-phenyl-2-pyrrolidin-1-ylethyl)-3-(trifluoromethyl)piperidin-2-one (PubChem CID 19421901) has the molecular formula C24H27F3N2O and a molecular weight of 416.49 g/mol. Its IUPAC name is 3-phenyl-1-(1-phenyl-2-pyrrolidin-1-ylethyl)-3-(trifluoromethyl)piperidin-2-one.
| Compound Name | 3-phenyl-1-(1-phenyl-2-pyrrolidin-1-ylethyl)-3-(trifluoromethyl)piperidin-2-one |
|---|---|
| PubChem CID | 19421901 |
| Molecular Formula | C24H27F3N2O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 3-phenyl-1-(1-phenyl-2-pyrrolidin-1-ylethyl)-3-(trifluoromethyl)piperidin-2-one |
| SMILES | O=C1N(C(CN2CCCC2)c2ccccc2)CCCC1(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H27F3N2O/c25-24(26,27)23(20-12-5-2-6-13-20)14-9-17-29(22(23)30)21(18-28-15-7-8-16-28)19-10-3-1-4-11-19/h1-6,10-13,21H,7-9,14-18H2 |
| InChIKey | IKTWTKIOFPFNTQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |