C20H16Cl2F2N2O3 — CID 19435005
N-[4-(7-amino-6,8-difluoro-4-oxochromen-2-yl)-2,6-dichlorophenyl]-2,2-dimethylpropanamide (PubChem CID 19435005) has the molecular formula C20H16Cl2F2N2O3 and a molecular weight of 441.26 g/mol. Its IUPAC name is N-[4-(7-amino-6,8-difluoro-4-oxochromen-2-yl)-2,6-dichlorophenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(7-amino-6,8-difluoro-4-oxochromen-2-yl)-2,6-dichlorophenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 19435005 |
| Molecular Formula | C20H16Cl2F2N2O3 |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | N-[4-(7-amino-6,8-difluoro-4-oxochromen-2-yl)-2,6-dichlorophenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1c(Cl)cc(-c2cc(=O)c3cc(F)c(N)c(F)c3o2)cc1Cl |
| InChI | InChI=1S/C20H16Cl2F2N2O3/c1-20(2,3)19(28)26-17-10(21)4-8(5-11(17)22)14-7-13(27)9-6-12(23)16(25)15(24)18(9)29-14/h4-7H,25H2,1-3H3,(H,26,28) |
| InChIKey | FFAMSBNZQUBMMI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|