C32H48O5S — CID 19437949
4-[6-(3,5-ditert-butyl-4-methoxyphenyl)sulfanylhexoxy]-2-methoxy-3,5,6-trimethylbenzoic acid (PubChem CID 19437949) has the molecular formula C32H48O5S and a molecular weight of 544.80 g/mol. Its IUPAC name is 4-[6-(3,5-ditert-butyl-4-methoxyphenyl)sulfanylhexoxy]-2-methoxy-3,5,6-trimethylbenzoic acid.
| Compound Name | 4-[6-(3,5-ditert-butyl-4-methoxyphenyl)sulfanylhexoxy]-2-methoxy-3,5,6-trimethylbenzoic acid |
|---|---|
| PubChem CID | 19437949 |
| Molecular Formula | C32H48O5S |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | 4-[6-(3,5-ditert-butyl-4-methoxyphenyl)sulfanylhexoxy]-2-methoxy-3,5,6-trimethylbenzoic acid |
| SMILES | COc1c(C(C)(C)C)cc(SCCCCCCOc2c(C)c(C)c(C(=O)O)c(OC)c2C)cc1C(C)(C)C |
| InChI | InChI=1S/C32H48O5S/c1-20-21(2)27(22(3)28(35-10)26(20)30(33)34)37-16-14-12-13-15-17-38-23-18-24(31(4,5)6)29(36-11)25(19-23)32(7,8)9/h18-19H,12-17H2,1-11H3,(H,33,34) |
| InChIKey | OPVKRMSAFPBXPB-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|