C13H15N4O5S+ — CID 19438398
ethyl 1-methyl-5-(pyridin-1-ium-1-carbonylsulfamoyl)pyrazole-4-carboxylate (PubChem CID 19438398) has the molecular formula C13H15N4O5S+ and a molecular weight of 339.35 g/mol. Its IUPAC name is ethyl 1-methyl-5-(pyridin-1-ium-1-carbonylsulfamoyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-(pyridin-1-ium-1-carbonylsulfamoyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19438398 |
| Molecular Formula | C13H15N4O5S+ |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | ethyl 1-methyl-5-(pyridin-1-ium-1-carbonylsulfamoyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1S(=O)(=O)NC(=O)[n+]1ccccc1 |
| InChI | InChI=1S/C13H14N4O5S/c1-3-22-12(18)10-9-14-16(2)11(10)23(20,21)15-13(19)17-7-5-4-6-8-17/h4-9H,3H2,1-2H3/p+1 |
| InChIKey | AEXJKQCZUNXWSN-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|