About ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate
ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate (PubChem CID 14577225) has the molecular formula C15H19N5O7S
and a molecular weight of 413.41 g/mol. Its IUPAC name is ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate |
| PubChem CID | 14577225 |
| Molecular Formula | C15H19N5O7S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1S(=O)(=O)NC(=O)Nc1cc(OC)cc(OC)n1 |
| InChI | InChI=1S/C15H19N5O7S/c1-5-27-14(21)10-8-16-20(2)13(10)28(23,24)19-15(22)18-11-6-9(25-3)7-12(17-11)26-4/h6-8H,5H2,1-4H3,(H2,17,18,19,22) |
| InChIKey | VQSITJSIDKGHFK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 150.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate?
The IUPAC name of ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate (CID 14577225) is ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate is CCOC(=O)c1cnn(C)c1S(=O)(=O)NC(=O)Nc1cc(OC)cc(OC)n1.
What is the InChIKey of ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate?
The InChIKey is VQSITJSIDKGHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O7S/c1-5-27-14(21)10-8-16-20(2)13(10)28(23,24)19-15(22)18-11-6-9(25-3)7-12(17-11)26-4/h6-8H,5H2,1-4H3,(H2,17,18,19,22).
What are the key properties of ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate?
ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate has a molecular weight of 413.41 g/mol, XLogP of 0.52, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate is sourced from PubChem (CID 14577225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).