C22H29Cl2N7O8S — CID 89395751
2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate (PubChem CID 89395751) has the molecular formula C22H29Cl2N7O8S and a molecular weight of 622.49 g/mol. Its IUPAC name is 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate.
| Compound Name | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 89395751 |
| Molecular Formula | C22H29Cl2N7O8S |
| Molecular Weight | 622.49 g/mol |
| Exact Mass | 621.12 |
| IUPAC Name | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylate |
| SMILES | C=CCN(CC=C)C(=O)C(Cl)Cl.CCOC(=O)c1cnn(C)c1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C14H18N6O7S.C8H11Cl2NO/c1-5-27-12(21)8-7-15-20(2)11(8)28(23,24)19-14(22)18-13-16-9(25-3)6-10(17-13)26-4;1-3-5-11(6-4-2)8(12)7(9)10/h6-7H,5H2,1-4H3,(H2,16,17,18,19,22);3-4,7H,1-2,5-6H2 |
| InChIKey | JALPARDDVIRCTF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|