C24H30Cl2N6O10S2 — CID 67383891
2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoic acid (PubChem CID 67383891) has the molecular formula C24H30Cl2N6O10S2 and a molecular weight of 697.58 g/mol. Its IUPAC name is 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoic acid.
| Compound Name | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoic acid |
|---|---|
| PubChem CID | 67383891 |
| Molecular Formula | C24H30Cl2N6O10S2 |
| Molecular Weight | 697.58 g/mol |
| Exact Mass | 696.08 |
| IUPAC Name | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoic acid |
| SMILES | C=CCN(CC=C)C(=O)C(Cl)Cl.COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2cc(CNS(C)(=O)=O)ccc2C(=O)O)n1 |
| InChI | InChI=1S/C16H19N5O9S2.C8H11Cl2NO/c1-29-12-7-13(30-2)19-15(18-12)20-16(24)21-32(27,28)11-6-9(8-17-31(3,25)26)4-5-10(11)14(22)23;1-3-5-11(6-4-2)8(12)7(9)10/h4-7,17H,8H2,1-3H3,(H,22,23)(H2,18,19,20,21,24);3-4,7H,1-2,5-6H2 |
| InChIKey | ZWUQZEWGXPZEBX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 223.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.58 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|