C10H15N4O7S2- — CID 174334464
[(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl-methylamino]methanesulfinate (PubChem CID 174334464) has the molecular formula C10H15N4O7S2- and a molecular weight of 367.39 g/mol. Its IUPAC name is [(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl-methylamino]methanesulfinate.
| Compound Name | [(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl-methylamino]methanesulfinate |
|---|---|
| PubChem CID | 174334464 |
| Molecular Formula | C10H15N4O7S2- |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [(4,6-dimethoxy-2-pyridinyl)carbamoylsulfamoyl-methylamino]methanesulfinate |
| SMILES | COc1cc(NC(=O)NS(=O)(=O)N(C)CS(=O)[O-])nc(OC)c1 |
| InChI | InChI=1S/C10H16N4O7S2/c1-14(6-22(16)17)23(18,19)13-10(15)12-8-4-7(20-2)5-9(11-8)21-3/h4-5H,6H2,1-3H3,(H,16,17)(H2,11,12,13,15)/p-1 |
| InChIKey | UATIRXDEEAQRTK-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 149.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|