C10H16N4O5S — CID 142669824
1-(4,6-dimethoxy-2-pyridinyl)-3-methyl-1-(methylsulfamoyl)urea (PubChem CID 142669824) has the molecular formula C10H16N4O5S and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-2-pyridinyl)-3-methyl-1-(methylsulfamoyl)urea.
| Compound Name | 1-(4,6-dimethoxy-2-pyridinyl)-3-methyl-1-(methylsulfamoyl)urea |
|---|---|
| PubChem CID | 142669824 |
| Molecular Formula | C10H16N4O5S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-(4,6-dimethoxy-2-pyridinyl)-3-methyl-1-(methylsulfamoyl)urea |
| SMILES | CNC(=O)N(c1cc(OC)cc(OC)n1)S(=O)(=O)NC |
| InChI | InChI=1S/C10H16N4O5S/c1-11-10(15)14(20(16,17)12-2)8-5-7(18-3)6-9(13-8)19-4/h5-6,12H,1-4H3,(H,11,15) |
| InChIKey | XMFBDNXZGCKJOB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |