C28H23ClN2O6 — CID 19458932
N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxamide (PubChem CID 19458932) has the molecular formula C28H23ClN2O6 and a molecular weight of 518.95 g/mol. Its IUPAC name is N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19458932 |
| Molecular Formula | C28H23ClN2O6 |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-5-(2,3-dihydro-1H-inden-5-yloxymethyl)furan-2-carboxamide |
| SMILES | Cc1cc(Oc2cc(NC(=O)c3ccc(COc4ccc5c(c4)CCC5)o3)cc([N+](=O)[O-])c2)ccc1Cl |
| InChI | InChI=1S/C28H23ClN2O6/c1-17-11-23(7-9-26(17)29)36-25-14-20(13-21(15-25)31(33)34)30-28(32)27-10-8-24(37-27)16-35-22-6-5-18-3-2-4-19(18)12-22/h5-15H,2-4,16H2,1H3,(H,30,32) |
| InChIKey | LLZVVXLXAIACMB-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|