C15H17BrN4O5 — CID 19476787
4-bromo-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1-ethylpyrazole-5-carboxamide (PubChem CID 19476787) has the molecular formula C15H17BrN4O5 and a molecular weight of 413.23 g/mol. Its IUPAC name is 4-bromo-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476787 |
| Molecular Formula | C15H17BrN4O5 |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-bromo-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(Br)c1C(=O)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17BrN4O5/c1-2-19-13(11(16)7-17-19)15(23)18-12(8-21)14(22)9-3-5-10(6-4-9)20(24)25/h3-7,12,14,21-22H,2,8H2,1H3,(H,18,23) |
| InChIKey | CCMBZMVBXDXJNX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|