C16H14Cl2OS — CID 19545087
(E)-3-(2,4-dichlorophenyl)-1-(5-propylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19545087) has the molecular formula C16H14Cl2OS and a molecular weight of 325.26 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-1-(5-propylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-1-(5-propylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19545087 |
| Molecular Formula | C16H14Cl2OS |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-1-(5-propylthiophen-2-yl)prop-2-en-1-one |
| SMILES | CCCc1ccc(C(=O)/C=C/c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C16H14Cl2OS/c1-2-3-13-7-9-16(20-13)15(19)8-5-11-4-6-12(17)10-14(11)18/h4-10H,2-3H2,1H3/b8-5+ |
| InChIKey | ZHOLFKCNNGZLCG-VMPITWQZSA-N |
| XLogP | 5.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|